C8H12 — CID 102070910
(2R,3S)-2,3-dimethylbicyclo[2.2.0]hex-1(4)-ene (PubChem CID 102070910) has the molecular formula C8H12 and a molecular weight of 108.18 g/mol. Its IUPAC name is (2R,3S)-2,3-dimethylbicyclo[2.2.0]hex-1(4)-ene.
| Compound Name | (2R,3S)-2,3-dimethylbicyclo[2.2.0]hex-1(4)-ene |
|---|---|
| PubChem CID | 102070910 |
| Molecular Formula | C8H12 |
| Molecular Weight | 108.18 g/mol |
| Exact Mass | 108.09 |
| IUPAC Name | (2R,3S)-2,3-dimethylbicyclo[2.2.0]hex-1(4)-ene |
| SMILES | C[C@@H]1C2=C(CC2)[C@@H]1C |
| InChI | InChI=1S/C8H12/c1-5-6(2)8-4-3-7(5)8/h5-6H,3-4H2,1-2H3/t5-,6+ |
| InChIKey | ILOFZVVALXIOGA-OLQVQODUSA-N |
| XLogP | 2.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 108.18 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|