C16H10N2O3 — CID 102071789
14-methyl-18-oxa-14,16-diazatetracyclo[9.7.0.03,8.012,17]octadeca-1,3,5,7,9,11,16-heptaene-13,15-dione (PubChem CID 102071789) has the molecular formula C16H10N2O3 and a molecular weight of 278.27 g/mol. Its IUPAC name is 14-methyl-18-oxa-14,16-diazatetracyclo[9.7.0.03,8.012,17]octadeca-1,3,5,7,9,11,16-heptaene-13,15-dione.
| Compound Name | 14-methyl-18-oxa-14,16-diazatetracyclo[9.7.0.03,8.012,17]octadeca-1,3,5,7,9,11,16-heptaene-13,15-dione |
|---|---|
| PubChem CID | 102071789 |
| Molecular Formula | C16H10N2O3 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 14-methyl-18-oxa-14,16-diazatetracyclo[9.7.0.03,8.012,17]octadeca-1,3,5,7,9,11,16-heptaene-13,15-dione |
| SMILES | Cn1c(=O)nc2oc3cc4ccccc4ccc3c2c1=O |
| InChI | InChI=1S/C16H10N2O3/c1-18-15(19)13-11-7-6-9-4-2-3-5-10(9)8-12(11)21-14(13)17-16(18)20/h2-8H,1H3 |
| InChIKey | RRCADFLTGMJUQB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |