C30H33N3 — CID 102075939
4-[[4-[(3,8-dimethyl-5-propan-2-ylazulen-1-yl)methyl]phenyl]diazenyl]-N,N-dimethylaniline (PubChem CID 102075939) has the molecular formula C30H33N3 and a molecular weight of 435.62 g/mol. Its IUPAC name is 4-[[4-[(3,8-dimethyl-5-propan-2-ylazulen-1-yl)methyl]phenyl]diazenyl]-N,N-dimethylaniline.
| Compound Name | 4-[[4-[(3,8-dimethyl-5-propan-2-ylazulen-1-yl)methyl]phenyl]diazenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 102075939 |
| Molecular Formula | C30H33N3 |
| Molecular Weight | 435.62 g/mol |
| Exact Mass | 435.27 |
| IUPAC Name | 4-[[4-[(3,8-dimethyl-5-propan-2-ylazulen-1-yl)methyl]phenyl]diazenyl]-N,N-dimethylaniline |
| SMILES | Cc1cc(Cc2ccc(/N=N/c3ccc(N(C)C)cc3)cc2)c2c(C)ccc(C(C)C)cc1-2 |
| InChI | InChI=1S/C30H33N3/c1-20(2)24-10-7-21(3)30-25(17-22(4)29(30)19-24)18-23-8-11-26(12-9-23)31-32-27-13-15-28(16-14-27)33(5)6/h7-17,19-20H,18H2,1-6H3/b32-31+ |
| InChIKey | CMCKYFBWZSEVCR-QNEJGDQOSA-N |
| XLogP | 8.60 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.62 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|