C10H14O4S — CID 102082166
3-(1,4-dioxopentan-3-ylsulfanyl)-4-oxopentanal (PubChem CID 102082166) has the molecular formula C10H14O4S and a molecular weight of 230.28 g/mol. Its IUPAC name is 3-(1,4-dioxopentan-3-ylsulfanyl)-4-oxopentanal.
| Compound Name | 3-(1,4-dioxopentan-3-ylsulfanyl)-4-oxopentanal |
|---|---|
| PubChem CID | 102082166 |
| Molecular Formula | C10H14O4S |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 3-(1,4-dioxopentan-3-ylsulfanyl)-4-oxopentanal |
| SMILES | CC(=O)C(CC=O)SC(CC=O)C(C)=O |
| InChI | InChI=1S/C10H14O4S/c1-7(13)9(3-5-11)15-10(4-6-12)8(2)14/h5-6,9-10H,3-4H2,1-2H3 |
| InChIKey | USMRFDQHCTZFGG-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|