About S-(1,4-dioxoheptan-3-yl) ethanethioate
S-(1,4-dioxoheptan-3-yl) ethanethioate (PubChem CID 71363968) has the molecular formula C9H14O3S
and a molecular weight of 202.27 g/mol. Its IUPAC name is S-(1,4-dioxoheptan-3-yl) ethanethioate.
Molecular Properties
| Compound Name | S-(1,4-dioxoheptan-3-yl) ethanethioate |
| PubChem CID | 71363968 |
| Molecular Formula | C9H14O3S |
| Molecular Weight | 202.27 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | S-(1,4-dioxoheptan-3-yl) ethanethioate |
| SMILES | CCCC(=O)C(CC=O)SC(C)=O |
| InChI | InChI=1S/C9H14O3S/c1-3-4-8(12)9(5-6-10)13-7(2)11/h6,9H,3-5H2,1-2H3 |
| InChIKey | OJTFZHVGDPAPDK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(1,4-dioxoheptan-3-yl) ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(1,4-dioxoheptan-3-yl) ethanethioate?
The IUPAC name of S-(1,4-dioxoheptan-3-yl) ethanethioate (CID 71363968) is S-(1,4-dioxoheptan-3-yl) ethanethioate.
What is the SMILES notation for S-(1,4-dioxoheptan-3-yl) ethanethioate?
The canonical SMILES for S-(1,4-dioxoheptan-3-yl) ethanethioate is CCCC(=O)C(CC=O)SC(C)=O.
What is the InChIKey of S-(1,4-dioxoheptan-3-yl) ethanethioate?
The InChIKey is OJTFZHVGDPAPDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3S/c1-3-4-8(12)9(5-6-10)13-7(2)11/h6,9H,3-5H2,1-2H3.
What are the key properties of S-(1,4-dioxoheptan-3-yl) ethanethioate?
S-(1,4-dioxoheptan-3-yl) ethanethioate has a molecular weight of 202.27 g/mol, XLogP of 1.59, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(1,4-dioxoheptan-3-yl) ethanethioate is sourced from PubChem (CID 71363968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).