C20H12F9NO5 — CID 102084496
(5R)-5-[(1R)-2-nitro-1-phenylethyl]-2,2-bis(trifluoromethyl)-5-[4-(trifluoromethyl)phenyl]-1,3-dioxolan-4-one (PubChem CID 102084496) has the molecular formula C20H12F9NO5 and a molecular weight of 517.30 g/mol. Its IUPAC name is (5R)-5-[(1R)-2-nitro-1-phenylethyl]-2,2-bis(trifluoromethyl)-5-[4-(trifluoromethyl)phenyl]-1,3-dioxolan-4-one.
| Compound Name | (5R)-5-[(1R)-2-nitro-1-phenylethyl]-2,2-bis(trifluoromethyl)-5-[4-(trifluoromethyl)phenyl]-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 102084496 |
| Molecular Formula | C20H12F9NO5 |
| Molecular Weight | 517.30 g/mol |
| Exact Mass | 517.06 |
| IUPAC Name | (5R)-5-[(1R)-2-nitro-1-phenylethyl]-2,2-bis(trifluoromethyl)-5-[4-(trifluoromethyl)phenyl]-1,3-dioxolan-4-one |
| SMILES | O=C1OC(C(F)(F)F)(C(F)(F)F)O[C@@]1(c1ccc(C(F)(F)F)cc1)[C@@H](C[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C20H12F9NO5/c21-17(22,23)13-8-6-12(7-9-13)16(14(10-30(32)33)11-4-2-1-3-5-11)15(31)34-18(35-16,19(24,25)26)20(27,28)29/h1-9,14H,10H2/t14-,16-/m0/s1 |
| InChIKey | WQGDZQJGUSWOMC-HOCLYGCPSA-N |
| XLogP | 5.36 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.30 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|