C18H17NO5S — CID 132919048
(2S)-2-(benzenesulfonyl)-2-[(1S)-2-nitro-1-phenylethyl]cyclobutan-1-one (PubChem CID 132919048) has the molecular formula C18H17NO5S and a molecular weight of 359.40 g/mol. Its IUPAC name is (2S)-2-(benzenesulfonyl)-2-[(1S)-2-nitro-1-phenylethyl]cyclobutan-1-one.
| Compound Name | (2S)-2-(benzenesulfonyl)-2-[(1S)-2-nitro-1-phenylethyl]cyclobutan-1-one |
|---|---|
| PubChem CID | 132919048 |
| Molecular Formula | C18H17NO5S |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | (2S)-2-(benzenesulfonyl)-2-[(1S)-2-nitro-1-phenylethyl]cyclobutan-1-one |
| SMILES | O=C1CC[C@@]1([C@H](C[N+](=O)[O-])c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H17NO5S/c20-17-11-12-18(17,25(23,24)15-9-5-2-6-10-15)16(13-19(21)22)14-7-3-1-4-8-14/h1-10,16H,11-13H2/t16-,18+/m1/s1 |
| InChIKey | KOLJEICJTGDFRH-AEFFLSMTSA-N |
| XLogP | 2.62 |
| TPSA | 94.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|