C27H41N2O- — CID 102084848
2-(4-decoxybenzene-6-id-1-yl)-5-heptylpyrimidine (PubChem CID 102084848) has the molecular formula C27H41N2O- and a molecular weight of 409.64 g/mol. Its IUPAC name is 2-(4-decoxybenzene-6-id-1-yl)-5-heptylpyrimidine.
| Compound Name | 2-(4-decoxybenzene-6-id-1-yl)-5-heptylpyrimidine |
|---|---|
| PubChem CID | 102084848 |
| Molecular Formula | C27H41N2O- |
| Molecular Weight | 409.64 g/mol |
| Exact Mass | 409.32 |
| IUPAC Name | 2-(4-decoxybenzene-6-id-1-yl)-5-heptylpyrimidine |
| SMILES | CCCCCCCCCCOc1c[c-]c(-c2ncc(CCCCCCC)cn2)cc1 |
| InChI | InChI=1S/C27H41N2O/c1-3-5-7-9-10-11-13-15-21-30-26-19-17-25(18-20-26)27-28-22-24(23-29-27)16-14-12-8-6-4-2/h17,19-20,22-23H,3-16,21H2,1-2H3/q-1 |
| InChIKey | ILCUVOPDBRKEKH-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.64 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|