C22H32O — CID 102088991
4-(2-cyclohexylethynyl)-6-methyl-1-phenylheptan-3-ol (PubChem CID 102088991) has the molecular formula C22H32O and a molecular weight of 312.50 g/mol. Its IUPAC name is 4-(2-cyclohexylethynyl)-6-methyl-1-phenylheptan-3-ol.
| Compound Name | 4-(2-cyclohexylethynyl)-6-methyl-1-phenylheptan-3-ol |
|---|---|
| PubChem CID | 102088991 |
| Molecular Formula | C22H32O |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | 4-(2-cyclohexylethynyl)-6-methyl-1-phenylheptan-3-ol |
| SMILES | CC(C)CC(C#CC1CCCCC1)C(O)CCc1ccccc1 |
| InChI | InChI=1S/C22H32O/c1-18(2)17-21(15-13-19-9-5-3-6-10-19)22(23)16-14-20-11-7-4-8-12-20/h4,7-8,11-12,18-19,21-23H,3,5-6,9-10,14,16-17H2,1-2H3 |
| InChIKey | CKMFULLDGHGMPF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|