C28H28FN3O7 — CID 10208985
(4S,4aS,5aR,12aS)-9-(aminomethyl)-4-(dimethylamino)-7-(4-fluorophenyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 10208985) has the molecular formula C28H28FN3O7 and a molecular weight of 537.54 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-9-(aminomethyl)-4-(dimethylamino)-7-(4-fluorophenyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-9-(aminomethyl)-4-(dimethylamino)-7-(4-fluorophenyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 10208985 |
| Molecular Formula | C28H28FN3O7 |
| Molecular Weight | 537.54 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | (4S,4aS,5aR,12aS)-9-(aminomethyl)-4-(dimethylamino)-7-(4-fluorophenyl)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3C(=O)c4c(O)c(CN)cc(-c5ccc(F)cc5)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C28H28FN3O7/c1-32(2)21-17-9-12-7-16-15(11-3-5-14(29)6-4-11)8-13(10-30)22(33)19(16)23(34)18(12)25(36)28(17,39)26(37)20(24(21)35)27(31)38/h3-6,8,12,17-18,20-21,33,39H,7,9-10,30H2,1-2H3,(H2,31,38)/t12-,17-,18?,20?,21-,28-/m0/s1 |
| InChIKey | BQNHVWSKXCOTIC-QZPZFYOKSA-N |
| XLogP | 0.13 |
| TPSA | 181.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.54 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|