C29H38F4O4S — CID 102094012
(2R,3R,4S,5S)-5-decyl-3-fluoro-4-[(4-methylphenyl)sulfonylmethyl]-2-phenyl-3-(trifluoromethyl)oxolan-2-ol (PubChem CID 102094012) has the molecular formula C29H38F4O4S and a molecular weight of 558.68 g/mol. Its IUPAC name is (2R,3R,4S,5S)-5-decyl-3-fluoro-4-[(4-methylphenyl)sulfonylmethyl]-2-phenyl-3-(trifluoromethyl)oxolan-2-ol.
| Compound Name | (2R,3R,4S,5S)-5-decyl-3-fluoro-4-[(4-methylphenyl)sulfonylmethyl]-2-phenyl-3-(trifluoromethyl)oxolan-2-ol |
|---|---|
| PubChem CID | 102094012 |
| Molecular Formula | C29H38F4O4S |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | (2R,3R,4S,5S)-5-decyl-3-fluoro-4-[(4-methylphenyl)sulfonylmethyl]-2-phenyl-3-(trifluoromethyl)oxolan-2-ol |
| SMILES | CCCCCCCCCC[C@@H]1O[C@](O)(c2ccccc2)[C@@](F)(C(F)(F)F)[C@H]1CS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H38F4O4S/c1-3-4-5-6-7-8-9-13-16-26-25(21-38(35,36)24-19-17-22(2)18-20-24)27(30,29(31,32)33)28(34,37-26)23-14-11-10-12-15-23/h10-12,14-15,17-20,25-26,34H,3-9,13,16,21H2,1-2H3/t25-,26-,27+,28+/m0/s1 |
| InChIKey | XBWRGKZJLVEPAI-YVHASNINSA-N |
| XLogP | 7.43 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|