C20H18F6O4S — CID 89393947
2-[4-(1,1,2,2,3,3-hexafluorobutylsulfonyl)phenyl]-5-phenyl-1,3-dioxane (PubChem CID 89393947) has the molecular formula C20H18F6O4S and a molecular weight of 468.42 g/mol. Its IUPAC name is 2-[4-(1,1,2,2,3,3-hexafluorobutylsulfonyl)phenyl]-5-phenyl-1,3-dioxane.
| Compound Name | 2-[4-(1,1,2,2,3,3-hexafluorobutylsulfonyl)phenyl]-5-phenyl-1,3-dioxane |
|---|---|
| PubChem CID | 89393947 |
| Molecular Formula | C20H18F6O4S |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | 2-[4-(1,1,2,2,3,3-hexafluorobutylsulfonyl)phenyl]-5-phenyl-1,3-dioxane |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)S(=O)(=O)c1ccc(C2OCC(c3ccccc3)CO2)cc1 |
| InChI | InChI=1S/C20H18F6O4S/c1-18(21,22)19(23,24)20(25,26)31(27,28)16-9-7-14(8-10-16)17-29-11-15(12-30-17)13-5-3-2-4-6-13/h2-10,15,17H,11-12H2,1H3 |
| InChIKey | ADMCWFGJAKUVFA-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|