C20H18Cl4N4O2S2 — CID 10209503
1-N',3-N'-bis(2,5-dichlorobenzenecarbothioyl)-1-N',3-N',2-trimethylpropanedihydrazide (PubChem CID 10209503) has the molecular formula C20H18Cl4N4O2S2 and a molecular weight of 552.34 g/mol. Its IUPAC name is 1-N',3-N'-bis(2,5-dichlorobenzenecarbothioyl)-1-N',3-N',2-trimethylpropanedihydrazide.
| Compound Name | 1-N',3-N'-bis(2,5-dichlorobenzenecarbothioyl)-1-N',3-N',2-trimethylpropanedihydrazide |
|---|---|
| PubChem CID | 10209503 |
| Molecular Formula | C20H18Cl4N4O2S2 |
| Molecular Weight | 552.34 g/mol |
| Exact Mass | 549.96 |
| IUPAC Name | 1-N',3-N'-bis(2,5-dichlorobenzenecarbothioyl)-1-N',3-N',2-trimethylpropanedihydrazide |
| SMILES | CC(C(=O)NN(C)C(=S)c1cc(Cl)ccc1Cl)C(=O)NN(C)C(=S)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C20H18Cl4N4O2S2/c1-10(17(29)25-27(2)19(31)13-8-11(21)4-6-15(13)23)18(30)26-28(3)20(32)14-9-12(22)5-7-16(14)24/h4-10H,1-3H3,(H,25,29)(H,26,30) |
| InChIKey | YJPWOAXNZXJPLL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.34 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|