C38H32Cl8N8NaO4S4+ — CID 11578985
sodium bis(1-N',3-N'-bis(2,5-dichlorobenzenecarbothioyl)-1-N',3-N'-dimethylpropanedihydrazide) (PubChem CID 11578985) has the molecular formula C38H32Cl8N8NaO4S4+ and a molecular weight of 1099.61 g/mol. Its IUPAC name is sodium bis(1-N',3-N'-bis(2,5-dichlorobenzenecarbothioyl)-1-N',3-N'-dimethylpropanedihydrazide).
| Compound Name | sodium bis(1-N',3-N'-bis(2,5-dichlorobenzenecarbothioyl)-1-N',3-N'-dimethylpropanedihydrazide) |
|---|---|
| PubChem CID | 11578985 |
| Molecular Formula | C38H32Cl8N8NaO4S4+ |
| Molecular Weight | 1099.61 g/mol |
| Exact Mass | 1094.88 |
| IUPAC Name | sodium bis(1-N',3-N'-bis(2,5-dichlorobenzenecarbothioyl)-1-N',3-N'-dimethylpropanedihydrazide) |
| SMILES | CN(NC(=O)CC(=O)NN(C)C(=S)c1cc(Cl)ccc1Cl)C(=S)c1cc(Cl)ccc1Cl.CN(NC(=O)CC(=O)NN(C)C(=S)c1cc(Cl)ccc1Cl)C(=S)c1cc(Cl)ccc1Cl.[Na+] |
| InChI | InChI=1S/2C19H16Cl4N4O2S2.Na/c2*1-26(18(30)12-7-10(20)3-5-14(12)22)24-16(28)9-17(29)25-27(2)19(31)13-8-11(21)4-6-15(13)23;/h2*3-8H,9H2,1-2H3,(H,24,28)(H,25,29);/q;;+1 |
| InChIKey | AHDPUWYVKUGRNF-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 129.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1099.61 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|