C26H33Br3O10 — CID 102099055
[(2R,4aR,6S,7R,8S,8aR)-7-(2-bromo-2-methylpropanoyl)oxy-2-[2-(2-bromo-2-methylpropanoyl)oxyphenyl]-6-methoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2-bromo-2-methylpropanoate (PubChem CID 102099055) has the molecular formula C26H33Br3O10 and a molecular weight of 745.25 g/mol. Its IUPAC name is [(2R,4aR,6S,7R,8S,8aR)-7-(2-bromo-2-methylpropanoyl)oxy-2-[2-(2-bromo-2-methylpropanoyl)oxyphenyl]-6-methoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2-bromo-2-methylpropanoate.
| Compound Name | [(2R,4aR,6S,7R,8S,8aR)-7-(2-bromo-2-methylpropanoyl)oxy-2-[2-(2-bromo-2-methylpropanoyl)oxyphenyl]-6-methoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 102099055 |
| Molecular Formula | C26H33Br3O10 |
| Molecular Weight | 745.25 g/mol |
| Exact Mass | 741.96 |
| IUPAC Name | [(2R,4aR,6S,7R,8S,8aR)-7-(2-bromo-2-methylpropanoyl)oxy-2-[2-(2-bromo-2-methylpropanoyl)oxyphenyl]-6-methoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2-bromo-2-methylpropanoate |
| SMILES | CO[C@H]1O[C@@H]2CO[C@@H](c3ccccc3OC(=O)C(C)(C)Br)O[C@H]2[C@H](OC(=O)C(C)(C)Br)[C@H]1OC(=O)C(C)(C)Br |
| InChI | InChI=1S/C26H33Br3O10/c1-24(2,27)21(30)36-14-11-9-8-10-13(14)19-34-12-15-16(37-19)17(38-22(31)25(3,4)28)18(20(33-7)35-15)39-23(32)26(5,6)29/h8-11,15-20H,12H2,1-7H3/t15-,16-,17+,18-,19-,20+/m1/s1 |
| InChIKey | LQSGKHLUNJJWIY-FFDFYAMSSA-N |
| XLogP | 4.72 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.25 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|