C38H35NO2 — CID 102101116
4-[4-(4-ethynylphenyl)-2,6-dimethylphenyl]-N,N-bis(4-methoxyphenyl)-3,5-dimethylaniline (PubChem CID 102101116) has the molecular formula C38H35NO2 and a molecular weight of 537.70 g/mol. Its IUPAC name is 4-[4-(4-ethynylphenyl)-2,6-dimethylphenyl]-N,N-bis(4-methoxyphenyl)-3,5-dimethylaniline.
| Compound Name | 4-[4-(4-ethynylphenyl)-2,6-dimethylphenyl]-N,N-bis(4-methoxyphenyl)-3,5-dimethylaniline |
|---|---|
| PubChem CID | 102101116 |
| Molecular Formula | C38H35NO2 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | 4-[4-(4-ethynylphenyl)-2,6-dimethylphenyl]-N,N-bis(4-methoxyphenyl)-3,5-dimethylaniline |
| SMILES | C#Cc1ccc(-c2cc(C)c(-c3c(C)cc(N(c4ccc(OC)cc4)c4ccc(OC)cc4)cc3C)c(C)c2)cc1 |
| InChI | InChI=1S/C38H35NO2/c1-8-29-9-11-30(12-10-29)31-21-25(2)37(26(3)22-31)38-27(4)23-34(24-28(38)5)39(32-13-17-35(40-6)18-14-32)33-15-19-36(41-7)20-16-33/h1,9-24H,2-7H3 |
| InChIKey | BVSHUODYLVSJFP-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|