C21H20O7 — CID 102101755
[1,3-bis(4-formylphenoxy)-2-hydroxypropyl] 2-methylprop-2-enoate (PubChem CID 102101755) has the molecular formula C21H20O7 and a molecular weight of 384.38 g/mol. Its IUPAC name is [1,3-bis(4-formylphenoxy)-2-hydroxypropyl] 2-methylprop-2-enoate.
| Compound Name | [1,3-bis(4-formylphenoxy)-2-hydroxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102101755 |
| Molecular Formula | C21H20O7 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | [1,3-bis(4-formylphenoxy)-2-hydroxypropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(Oc1ccc(C=O)cc1)C(O)COc1ccc(C=O)cc1 |
| InChI | InChI=1S/C21H20O7/c1-14(2)20(25)28-21(27-18-9-5-16(12-23)6-10-18)19(24)13-26-17-7-3-15(11-22)4-8-17/h3-12,19,21,24H,1,13H2,2H3 |
| InChIKey | YPAMAPWOCADZCL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|