C30H32O4 — CID 102106559
2-[(1-tert-butylperoxy-3,4-dihydro-2H-naphthalen-1-yl)methyl]-1,3-diphenylpropane-1,3-dione (PubChem CID 102106559) has the molecular formula C30H32O4 and a molecular weight of 456.58 g/mol. Its IUPAC name is 2-[(1-tert-butylperoxy-3,4-dihydro-2H-naphthalen-1-yl)methyl]-1,3-diphenylpropane-1,3-dione.
| Compound Name | 2-[(1-tert-butylperoxy-3,4-dihydro-2H-naphthalen-1-yl)methyl]-1,3-diphenylpropane-1,3-dione |
|---|---|
| PubChem CID | 102106559 |
| Molecular Formula | C30H32O4 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 2-[(1-tert-butylperoxy-3,4-dihydro-2H-naphthalen-1-yl)methyl]-1,3-diphenylpropane-1,3-dione |
| SMILES | CC(C)(C)OOC1(CC(C(=O)c2ccccc2)C(=O)c2ccccc2)CCCc2ccccc21 |
| InChI | InChI=1S/C30H32O4/c1-29(2,3)33-34-30(20-12-18-22-13-10-11-19-26(22)30)21-25(27(31)23-14-6-4-7-15-23)28(32)24-16-8-5-9-17-24/h4-11,13-17,19,25H,12,18,20-21H2,1-3H3 |
| InChIKey | ZWQIPHIZUJJAGN-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|