C30H22N2O3 — CID 102109683
1'-benzylspiro[5,6,7,8-tetrahydroindeno[1,2-b]quinoline-10,3'-indole]-2',9,11-trione (PubChem CID 102109683) has the molecular formula C30H22N2O3 and a molecular weight of 458.52 g/mol. Its IUPAC name is 1'-benzylspiro[5,6,7,8-tetrahydroindeno[1,2-b]quinoline-10,3'-indole]-2',9,11-trione.
| Compound Name | 1'-benzylspiro[5,6,7,8-tetrahydroindeno[1,2-b]quinoline-10,3'-indole]-2',9,11-trione |
|---|---|
| PubChem CID | 102109683 |
| Molecular Formula | C30H22N2O3 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 1'-benzylspiro[5,6,7,8-tetrahydroindeno[1,2-b]quinoline-10,3'-indole]-2',9,11-trione |
| SMILES | O=C1CCCC2=C1C1(C(=O)N(Cc3ccccc3)c3ccccc31)C1=C(N2)c2ccccc2C1=O |
| InChI | InChI=1S/C30H22N2O3/c33-24-16-8-14-22-25(24)30(26-27(31-22)19-11-4-5-12-20(19)28(26)34)21-13-6-7-15-23(21)32(29(30)35)17-18-9-2-1-3-10-18/h1-7,9-13,15,31H,8,14,16-17H2 |
| InChIKey | VKSBTWVGRPCQKX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |