C25H28F6N6O8 — CID 10211706
ethyl 4-ethyl-2-[(4-methoxyanilino)methyl]-5-(1H-1,2,4-triazol-5-ylmethylcarbamoyl)-1H-pyrrole-3-carboxylate;bis(2,2,2-trifluoroacetic acid) (PubChem CID 10211706) has the molecular formula C25H28F6N6O8 and a molecular weight of 654.52 g/mol. Its IUPAC name is ethyl 4-ethyl-2-[(4-methoxyanilino)methyl]-5-(1H-1,2,4-triazol-5-ylmethylcarbamoyl)-1H-pyrrole-3-carboxylate;bis(2,2,2-trifluoroacetic acid).
| Compound Name | ethyl 4-ethyl-2-[(4-methoxyanilino)methyl]-5-(1H-1,2,4-triazol-5-ylmethylcarbamoyl)-1H-pyrrole-3-carboxylate;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 10211706 |
| Molecular Formula | C25H28F6N6O8 |
| Molecular Weight | 654.52 g/mol |
| Exact Mass | 654.19 |
| IUPAC Name | ethyl 4-ethyl-2-[(4-methoxyanilino)methyl]-5-(1H-1,2,4-triazol-5-ylmethylcarbamoyl)-1H-pyrrole-3-carboxylate;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCOC(=O)c1c(CNc2ccc(OC)cc2)[nH]c(C(=O)NCc2ncn[nH]2)c1CC.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H26N6O4.2C2HF3O2/c1-4-15-18(21(29)31-5-2)16(10-22-13-6-8-14(30-3)9-7-13)26-19(15)20(28)23-11-17-24-12-25-27-17;2*3-2(4,5)1(6)7/h6-9,12,22,26H,4-5,10-11H2,1-3H3,(H,23,28)(H,24,25,27);2*(H,6,7) |
| InChIKey | CVYLJXXBFGYZSF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 208.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|