C22H42N3O2+ — CID 102117912
diethyl-bis[[[(E)-oct-5-enoyl]amino]methyl]azanium (PubChem CID 102117912) has the molecular formula C22H42N3O2+ and a molecular weight of 380.60 g/mol. Its IUPAC name is diethyl-bis[[[(E)-oct-5-enoyl]amino]methyl]azanium.
| Compound Name | diethyl-bis[[[(E)-oct-5-enoyl]amino]methyl]azanium |
|---|---|
| PubChem CID | 102117912 |
| Molecular Formula | C22H42N3O2+ |
| Molecular Weight | 380.60 g/mol |
| Exact Mass | 380.33 |
| IUPAC Name | diethyl-bis[[[(E)-oct-5-enoyl]amino]methyl]azanium |
| SMILES | CC/C=C/CCCC(=O)NC[N+](CC)(CC)CNC(=O)CCC/C=C/CC |
| InChI | InChI=1S/C22H41N3O2/c1-5-9-11-13-15-17-21(26)23-19-25(7-3,8-4)20-24-22(27)18-16-14-12-10-6-2/h9-12H,5-8,13-20H2,1-4H3,(H-,23,24,26,27)/p+1/b11-9+,12-10+ |
| InChIKey | XDYUXMQMSOEBGP-WGDLNXRISA-O |
| XLogP | 4.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.60 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|