C16H18F6O8 — CID 102118591
bis(2-acetyloxy-4,4,4-trifluorobutyl) (Z)-but-2-enedioate (PubChem CID 102118591) has the molecular formula C16H18F6O8 and a molecular weight of 452.30 g/mol. Its IUPAC name is bis(2-acetyloxy-4,4,4-trifluorobutyl) (Z)-but-2-enedioate.
| Compound Name | bis(2-acetyloxy-4,4,4-trifluorobutyl) (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 102118591 |
| Molecular Formula | C16H18F6O8 |
| Molecular Weight | 452.30 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | bis(2-acetyloxy-4,4,4-trifluorobutyl) (Z)-but-2-enedioate |
| SMILES | CC(=O)OC(COC(=O)/C=C\C(=O)OCC(CC(F)(F)F)OC(C)=O)CC(F)(F)F |
| InChI | InChI=1S/C16H18F6O8/c1-9(23)29-11(5-15(17,18)19)7-27-13(25)3-4-14(26)28-8-12(30-10(2)24)6-16(20,21)22/h3-4,11-12H,5-8H2,1-2H3/b4-3- |
| InChIKey | KZEJMOXPFITNFV-ARJAWSKDSA-N |
| XLogP | 2.40 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|