C14H18N2O4 — CID 102119240
(4R,10S)-9-acetyl-10-hydroxy-4,6-dimethyl-5,7-dioxa-9-azatetracyclo[6.4.0.02,6.03,11]dodecane-4-carbonitrile (PubChem CID 102119240) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is (4R,10S)-9-acetyl-10-hydroxy-4,6-dimethyl-5,7-dioxa-9-azatetracyclo[6.4.0.02,6.03,11]dodecane-4-carbonitrile.
| Compound Name | (4R,10S)-9-acetyl-10-hydroxy-4,6-dimethyl-5,7-dioxa-9-azatetracyclo[6.4.0.02,6.03,11]dodecane-4-carbonitrile |
|---|---|
| PubChem CID | 102119240 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (4R,10S)-9-acetyl-10-hydroxy-4,6-dimethyl-5,7-dioxa-9-azatetracyclo[6.4.0.02,6.03,11]dodecane-4-carbonitrile |
| SMILES | CC(=O)N1C2OC3(C)OC(C)(C#N)C4C(CC2C43)[C@@H]1O |
| InChI | InChI=1S/C14H18N2O4/c1-6(17)16-11(18)7-4-8-10-9(7)13(2,5-15)20-14(10,3)19-12(8)16/h7-12,18H,4H2,1-3H3/t7?,8?,9?,10?,11-,12?,13?,14?/m0/s1 |
| InChIKey | GIWPXXNHBQNRHC-VFVRBUPZSA-N |
| XLogP | 0.42 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |