C16H26N3OSSi+ — CID 102119592
5-(4-methoxyanilino)-1,1,2-trimethyl-4-trimethylsilylpyrazol-1-ium-3-thione (PubChem CID 102119592) has the molecular formula C16H26N3OSSi+ and a molecular weight of 336.56 g/mol. Its IUPAC name is 5-(4-methoxyanilino)-1,1,2-trimethyl-4-trimethylsilylpyrazol-1-ium-3-thione.
| Compound Name | 5-(4-methoxyanilino)-1,1,2-trimethyl-4-trimethylsilylpyrazol-1-ium-3-thione |
|---|---|
| PubChem CID | 102119592 |
| Molecular Formula | C16H26N3OSSi+ |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 5-(4-methoxyanilino)-1,1,2-trimethyl-4-trimethylsilylpyrazol-1-ium-3-thione |
| SMILES | COc1ccc(NC2=C([Si](C)(C)C)C(=S)N(C)[N+]2(C)C)cc1 |
| InChI | InChI=1S/C16H25N3OSSi/c1-18-16(21)14(22(5,6)7)15(19(18,2)3)17-12-8-10-13(20-4)11-9-12/h8-11H,1-7H3/p+1 |
| InChIKey | FZKXNFSOHDZGDF-UHFFFAOYSA-O |
| XLogP | 3.46 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|