C18H33IO4Si — CID 102132532
methyl 2-[(2R,4S,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(E)-1-iodoprop-1-en-2-yl]-5-methyloxan-2-yl]acetate (PubChem CID 102132532) has the molecular formula C18H33IO4Si and a molecular weight of 468.45 g/mol. Its IUPAC name is methyl 2-[(2R,4S,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(E)-1-iodoprop-1-en-2-yl]-5-methyloxan-2-yl]acetate.
| Compound Name | methyl 2-[(2R,4S,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(E)-1-iodoprop-1-en-2-yl]-5-methyloxan-2-yl]acetate |
|---|---|
| PubChem CID | 102132532 |
| Molecular Formula | C18H33IO4Si |
| Molecular Weight | 468.45 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | methyl 2-[(2R,4S,5R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-[(E)-1-iodoprop-1-en-2-yl]-5-methyloxan-2-yl]acetate |
| SMILES | COC(=O)C[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](/C(C)=C/I)O1 |
| InChI | InChI=1S/C18H33IO4Si/c1-12(11-19)17-13(2)15(23-24(7,8)18(3,4)5)9-14(22-17)10-16(20)21-6/h11,13-15,17H,9-10H2,1-8H3/b12-11+/t13-,14+,15-,17+/m0/s1 |
| InChIKey | FASRTZZMUIOYJQ-NZUJIBSLSA-N |
| XLogP | 5.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|