C34H61IO5Si — CID 140619951
[(1E,4S)-1-iodo-4-methylhexa-1,5-dien-3-yl] 2-[(4R,6S)-6-[[(6R)-6-[(2S)-2-methylbutyl]oxan-2-yl]methyl]-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetate (PubChem CID 140619951) has the molecular formula C34H61IO5Si and a molecular weight of 704.85 g/mol. Its IUPAC name is [(1E,4S)-1-iodo-4-methylhexa-1,5-dien-3-yl] 2-[(4R,6S)-6-[[(6R)-6-[(2S)-2-methylbutyl]oxan-2-yl]methyl]-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetate.
| Compound Name | [(1E,4S)-1-iodo-4-methylhexa-1,5-dien-3-yl] 2-[(4R,6S)-6-[[(6R)-6-[(2S)-2-methylbutyl]oxan-2-yl]methyl]-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetate |
|---|---|
| PubChem CID | 140619951 |
| Molecular Formula | C34H61IO5Si |
| Molecular Weight | 704.85 g/mol |
| Exact Mass | 704.33 |
| IUPAC Name | [(1E,4S)-1-iodo-4-methylhexa-1,5-dien-3-yl] 2-[(4R,6S)-6-[[(6R)-6-[(2S)-2-methylbutyl]oxan-2-yl]methyl]-4-tri(propan-2-yl)silyloxyoxan-2-yl]acetate |
| SMILES | C=C[C@H](C)C(/C=C/I)OC(=O)CC1C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)C[C@H](CC2CCC[C@H](C[C@@H](C)CC)O2)O1 |
| InChI | InChI=1S/C34H61IO5Si/c1-11-26(9)18-28-14-13-15-29(37-28)19-30-20-32(40-41(23(3)4,24(5)6)25(7)8)21-31(38-30)22-34(36)39-33(16-17-35)27(10)12-2/h12,16-17,23-33H,2,11,13-15,18-22H2,1,3-10H3/b17-16+/t26-,27-,28+,29?,30-,31?,32+,33?/m0/s1 |
| InChIKey | QMIMLAZSGSSZHH-WWJQWPAUSA-N |
| XLogP | 9.93 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.85 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|