C22H22N4O5 — CID 102137471
methyl (2S,3S)-3-[4-(4-formylphenyl)triazol-1-yl]-2-(phenylmethoxycarbonylamino)butanoate (PubChem CID 102137471) has the molecular formula C22H22N4O5 and a molecular weight of 422.44 g/mol. Its IUPAC name is methyl (2S,3S)-3-[4-(4-formylphenyl)triazol-1-yl]-2-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | methyl (2S,3S)-3-[4-(4-formylphenyl)triazol-1-yl]-2-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 102137471 |
| Molecular Formula | C22H22N4O5 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | methyl (2S,3S)-3-[4-(4-formylphenyl)triazol-1-yl]-2-(phenylmethoxycarbonylamino)butanoate |
| SMILES | COC(=O)[C@@H](NC(=O)OCc1ccccc1)[C@H](C)n1cc(-c2ccc(C=O)cc2)nn1 |
| InChI | InChI=1S/C22H22N4O5/c1-15(26-12-19(24-25-26)18-10-8-16(13-27)9-11-18)20(21(28)30-2)23-22(29)31-14-17-6-4-3-5-7-17/h3-13,15,20H,14H2,1-2H3,(H,23,29)/t15-,20-/m0/s1 |
| InChIKey | LKOPLMPBRHJXMZ-YWZLYKJASA-N |
| XLogP | 2.79 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|