C11H10O2S — CID 102148026
11-sulfanyltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione (PubChem CID 102148026) has the molecular formula C11H10O2S and a molecular weight of 206.27 g/mol. Its IUPAC name is 11-sulfanyltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione.
| Compound Name | 11-sulfanyltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
|---|---|
| PubChem CID | 102148026 |
| Molecular Formula | C11H10O2S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 11-sulfanyltricyclo[6.2.1.02,7]undeca-4,9-diene-3,6-dione |
| SMILES | O=C1C=CC(=O)C2C3C=CC(C3S)C12 |
| InChI | InChI=1S/C11H10O2S/c12-7-3-4-8(13)10-6-2-1-5(9(7)10)11(6)14/h1-6,9-11,14H |
| InChIKey | WNKNQQMKPVQTKS-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|