C22H21N2+ — CID 102148779
5-methyl-1-phenyl-2-[(1S)-1-phenylethyl]imidazo[1,5-a]pyridin-2-ium (PubChem CID 102148779) has the molecular formula C22H21N2+ and a molecular weight of 313.42 g/mol. Its IUPAC name is 5-methyl-1-phenyl-2-[(1S)-1-phenylethyl]imidazo[1,5-a]pyridin-2-ium.
| Compound Name | 5-methyl-1-phenyl-2-[(1S)-1-phenylethyl]imidazo[1,5-a]pyridin-2-ium |
|---|---|
| PubChem CID | 102148779 |
| Molecular Formula | C22H21N2+ |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 5-methyl-1-phenyl-2-[(1S)-1-phenylethyl]imidazo[1,5-a]pyridin-2-ium |
| SMILES | Cc1cccc2c(-c3ccccc3)[n+]([C@@H](C)c3ccccc3)cn12 |
| InChI | InChI=1S/C22H21N2/c1-17-10-9-15-21-22(20-13-7-4-8-14-20)24(16-23(17)21)18(2)19-11-5-3-6-12-19/h3-16,18H,1-2H3/q+1/t18-/m0/s1 |
| InChIKey | XOXVSCSHYMGNOF-SFHVURJKSA-N |
| XLogP | 4.81 |
| TPSA | 8.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|