C26H28BrClO4Si — CID 102157051
[3-(3-bromo-4,7,8-trimethoxy-5-phenylmethoxynaphthalen-2-yl)-3-chloroprop-1-ynyl]-trimethylsilane (PubChem CID 102157051) has the molecular formula C26H28BrClO4Si and a molecular weight of 547.95 g/mol. Its IUPAC name is [3-(3-bromo-4,7,8-trimethoxy-5-phenylmethoxynaphthalen-2-yl)-3-chloroprop-1-ynyl]-trimethylsilane.
| Compound Name | [3-(3-bromo-4,7,8-trimethoxy-5-phenylmethoxynaphthalen-2-yl)-3-chloroprop-1-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 102157051 |
| Molecular Formula | C26H28BrClO4Si |
| Molecular Weight | 547.95 g/mol |
| Exact Mass | 546.06 |
| IUPAC Name | [3-(3-bromo-4,7,8-trimethoxy-5-phenylmethoxynaphthalen-2-yl)-3-chloroprop-1-ynyl]-trimethylsilane |
| SMILES | COc1cc(OCc2ccccc2)c2c(OC)c(Br)c(C(Cl)C#C[Si](C)(C)C)cc2c1OC |
| InChI | InChI=1S/C26H28BrClO4Si/c1-29-22-15-21(32-16-17-10-8-7-9-11-17)23-19(25(22)30-2)14-18(24(27)26(23)31-3)20(28)12-13-33(4,5)6/h7-11,14-15,20H,16H2,1-6H3 |
| InChIKey | GWDIJHDSUSVMRK-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.95 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|