C14H16 — CID 102160165
(1R,6S,7R)-3-methyl-7-phenylbicyclo[4.1.0]hept-3-ene (PubChem CID 102160165) has the molecular formula C14H16 and a molecular weight of 184.28 g/mol. Its IUPAC name is (1R,6S,7R)-3-methyl-7-phenylbicyclo[4.1.0]hept-3-ene.
| Compound Name | (1R,6S,7R)-3-methyl-7-phenylbicyclo[4.1.0]hept-3-ene |
|---|---|
| PubChem CID | 102160165 |
| Molecular Formula | C14H16 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | (1R,6S,7R)-3-methyl-7-phenylbicyclo[4.1.0]hept-3-ene |
| SMILES | CC1=CC[C@H]2[C@@H](C1)[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C14H16/c1-10-7-8-12-13(9-10)14(12)11-5-3-2-4-6-11/h2-7,12-14H,8-9H2,1H3/t12-,13+,14+/m0/s1 |
| InChIKey | ZUEGMSSRODBHAK-BFHYXJOUSA-N |
| XLogP | 3.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|