C19H30O3Si — CID 102160570
(1S,2R,4E,5S,6R)-6-[(E)-but-1-enoxy]-8-methyl-4-(trimethylsilylmethylidene)-11-oxatricyclo[4.3.2.01,5]undec-8-en-2-ol (PubChem CID 102160570) has the molecular formula C19H30O3Si and a molecular weight of 334.53 g/mol. Its IUPAC name is (1S,2R,4E,5S,6R)-6-[(E)-but-1-enoxy]-8-methyl-4-(trimethylsilylmethylidene)-11-oxatricyclo[4.3.2.01,5]undec-8-en-2-ol.
| Compound Name | (1S,2R,4E,5S,6R)-6-[(E)-but-1-enoxy]-8-methyl-4-(trimethylsilylmethylidene)-11-oxatricyclo[4.3.2.01,5]undec-8-en-2-ol |
|---|---|
| PubChem CID | 102160570 |
| Molecular Formula | C19H30O3Si |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | (1S,2R,4E,5S,6R)-6-[(E)-but-1-enoxy]-8-methyl-4-(trimethylsilylmethylidene)-11-oxatricyclo[4.3.2.01,5]undec-8-en-2-ol |
| SMILES | CC/C=C/O[C@@]12CC(C)=C[C@]3(CO1)[C@H](O)C/C(=C\[Si](C)(C)C)[C@@H]23 |
| InChI | InChI=1S/C19H30O3Si/c1-6-7-8-21-19-11-14(2)10-18(13-22-19)16(20)9-15(17(18)19)12-23(3,4)5/h7-8,10,12,16-17,20H,6,9,11,13H2,1-5H3/b8-7+,15-12+/t16-,17-,18+,19+/m1/s1 |
| InChIKey | IQRBHEPSBNFHEY-XNWWYGABSA-N |
| XLogP | 4.17 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|