C21H34O3Si — CID 44551490
(1S,2R,4E,5S,6R)-6-(2-ethylbut-1-enoxy)-8-methyl-4-(trimethylsilylmethylidene)-11-oxatricyclo[4.3.2.01,5]undec-8-en-2-ol (PubChem CID 44551490) has the molecular formula C21H34O3Si and a molecular weight of 362.59 g/mol. Its IUPAC name is (1S,2R,4E,5S,6R)-6-(2-ethylbut-1-enoxy)-8-methyl-4-(trimethylsilylmethylidene)-11-oxatricyclo[4.3.2.01,5]undec-8-en-2-ol.
| Compound Name | (1S,2R,4E,5S,6R)-6-(2-ethylbut-1-enoxy)-8-methyl-4-(trimethylsilylmethylidene)-11-oxatricyclo[4.3.2.01,5]undec-8-en-2-ol |
|---|---|
| PubChem CID | 44551490 |
| Molecular Formula | C21H34O3Si |
| Molecular Weight | 362.59 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | (1S,2R,4E,5S,6R)-6-(2-ethylbut-1-enoxy)-8-methyl-4-(trimethylsilylmethylidene)-11-oxatricyclo[4.3.2.01,5]undec-8-en-2-ol |
| SMILES | CCC(=CO[C@@]12CC(C)=C[C@]3(CO1)[C@H](O)C/C(=C\[Si](C)(C)C)[C@@H]23)CC |
| InChI | InChI=1S/C21H34O3Si/c1-7-16(8-2)12-23-21-11-15(3)10-20(14-24-21)18(22)9-17(19(20)21)13-25(4,5)6/h10,12-13,18-19,22H,7-9,11,14H2,1-6H3/b17-13+/t18-,19-,20+,21+/m1/s1 |
| InChIKey | AJXRNAFXIJBBLO-OQNYRBTLSA-N |
| XLogP | 4.95 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.59 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|