C32H40N6O7 — CID 102161038
(2S)-2-acetamido-6-amino-N-[(2S)-1-amino-6-(13-butyl-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl)-1-oxohexan-2-yl]hexanamide (PubChem CID 102161038) has the molecular formula C32H40N6O7 and a molecular weight of 620.71 g/mol. Its IUPAC name is (2S)-2-acetamido-6-amino-N-[(2S)-1-amino-6-(13-butyl-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl)-1-oxohexan-2-yl]hexanamide.
| Compound Name | (2S)-2-acetamido-6-amino-N-[(2S)-1-amino-6-(13-butyl-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl)-1-oxohexan-2-yl]hexanamide |
|---|---|
| PubChem CID | 102161038 |
| Molecular Formula | C32H40N6O7 |
| Molecular Weight | 620.71 g/mol |
| Exact Mass | 620.30 |
| IUPAC Name | (2S)-2-acetamido-6-amino-N-[(2S)-1-amino-6-(13-butyl-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl)-1-oxohexan-2-yl]hexanamide |
| SMILES | CCCCN1C(=O)c2ccc3c4c(ccc(c24)C1=O)C(=O)N(CCCC[C@H](NC(=O)[C@H](CCCCN)NC(C)=O)C(N)=O)C3=O |
| InChI | InChI=1S/C32H40N6O7/c1-3-4-16-37-29(42)19-11-13-21-26-22(14-12-20(25(19)26)30(37)43)32(45)38(31(21)44)17-8-6-9-23(27(34)40)36-28(41)24(35-18(2)39)10-5-7-15-33/h11-14,23-24H,3-10,15-17,33H2,1-2H3,(H2,34,40)(H,35,39)(H,36,41)/t23-,24-/m0/s1 |
| InChIKey | PMNXELDNWGDHOX-ZEQRLZLVSA-N |
| XLogP | 1.61 |
| TPSA | 202.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.71 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|