C30H38N6O6 — CID 102161040
(2S)-2,6-diamino-N-[(2S)-1-amino-6-(13-butyl-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl)-1-oxohexan-2-yl]hexanamide (PubChem CID 102161040) has the molecular formula C30H38N6O6 and a molecular weight of 578.67 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[(2S)-1-amino-6-(13-butyl-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl)-1-oxohexan-2-yl]hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[(2S)-1-amino-6-(13-butyl-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl)-1-oxohexan-2-yl]hexanamide |
|---|---|
| PubChem CID | 102161040 |
| Molecular Formula | C30H38N6O6 |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.29 |
| IUPAC Name | (2S)-2,6-diamino-N-[(2S)-1-amino-6-(13-butyl-5,7,12,14-tetraoxo-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaen-6-yl)-1-oxohexan-2-yl]hexanamide |
| SMILES | CCCCN1C(=O)c2ccc3c4c(ccc(c24)C1=O)C(=O)N(CCCC[C@H](NC(=O)[C@@H](N)CCCCN)C(N)=O)C3=O |
| InChI | InChI=1S/C30H38N6O6/c1-2-3-15-35-27(39)17-10-12-19-24-20(13-11-18(23(17)24)28(35)40)30(42)36(29(19)41)16-7-5-9-22(25(33)37)34-26(38)21(32)8-4-6-14-31/h10-13,21-22H,2-9,14-16,31-32H2,1H3,(H2,33,37)(H,34,38)/t21-,22-/m0/s1 |
| InChIKey | FFHJGSFPHCVQOO-VXKWHMMOSA-N |
| XLogP | 1.43 |
| TPSA | 198.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|