C13H30N8O3 — CID 122462120
(2R)-2,5-diamino-N-[(2R)-1-[[(2R)-1,5-diamino-1-oxopentan-2-yl]amino]-3-hydrazinyl-1-oxopropan-2-yl]pentanamide (PubChem CID 122462120) has the molecular formula C13H30N8O3 and a molecular weight of 346.44 g/mol. Its IUPAC name is (2R)-2,5-diamino-N-[(2R)-1-[[(2R)-1,5-diamino-1-oxopentan-2-yl]amino]-3-hydrazinyl-1-oxopropan-2-yl]pentanamide.
| Compound Name | (2R)-2,5-diamino-N-[(2R)-1-[[(2R)-1,5-diamino-1-oxopentan-2-yl]amino]-3-hydrazinyl-1-oxopropan-2-yl]pentanamide |
|---|---|
| PubChem CID | 122462120 |
| Molecular Formula | C13H30N8O3 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | (2R)-2,5-diamino-N-[(2R)-1-[[(2R)-1,5-diamino-1-oxopentan-2-yl]amino]-3-hydrazinyl-1-oxopropan-2-yl]pentanamide |
| SMILES | NCCC[C@@H](N)C(=O)N[C@H](CNN)C(=O)N[C@H](CCCN)C(N)=O |
| InChI | InChI=1S/C13H30N8O3/c14-5-1-3-8(16)12(23)21-10(7-19-18)13(24)20-9(11(17)22)4-2-6-15/h8-10,19H,1-7,14-16,18H2,(H2,17,22)(H,20,24)(H,21,23)/t8-,9-,10-/m1/s1 |
| InChIKey | BAGALSSUAVAJDM-OPRDCNLKSA-N |
| XLogP | -4.29 |
| TPSA | 217.40 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | -4.29 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|