C8H18N4O2S — CID 54003178
(2S)-2,5-diamino-N-[(2R)-1-amino-1-oxo-3-sulfanylpropan-2-yl]pentanamide (PubChem CID 54003178) has the molecular formula C8H18N4O2S and a molecular weight of 234.32 g/mol. Its IUPAC name is (2S)-2,5-diamino-N-[(2R)-1-amino-1-oxo-3-sulfanylpropan-2-yl]pentanamide.
| Compound Name | (2S)-2,5-diamino-N-[(2R)-1-amino-1-oxo-3-sulfanylpropan-2-yl]pentanamide |
|---|---|
| PubChem CID | 54003178 |
| Molecular Formula | C8H18N4O2S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | (2S)-2,5-diamino-N-[(2R)-1-amino-1-oxo-3-sulfanylpropan-2-yl]pentanamide |
| SMILES | NCCC[C@H](N)C(=O)N[C@@H](CS)C(N)=O |
| InChI | InChI=1S/C8H18N4O2S/c9-3-1-2-5(10)8(14)12-6(4-15)7(11)13/h5-6,15H,1-4,9-10H2,(H2,11,13)(H,12,14)/t5-,6-/m0/s1 |
| InChIKey | KNAPVIXSDMFPCL-WDSKDSINSA-N |
| XLogP | -2.05 |
| TPSA | 124.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|