C8H17N3O2S2 — CID 118120024
2-amino-N-(1-amino-1-oxo-4-sulfanylbutan-2-yl)-4-sulfanylbutanamide (PubChem CID 118120024) has the molecular formula C8H17N3O2S2 and a molecular weight of 251.38 g/mol. Its IUPAC name is 2-amino-N-(1-amino-1-oxo-4-sulfanylbutan-2-yl)-4-sulfanylbutanamide.
| Compound Name | 2-amino-N-(1-amino-1-oxo-4-sulfanylbutan-2-yl)-4-sulfanylbutanamide |
|---|---|
| PubChem CID | 118120024 |
| Molecular Formula | C8H17N3O2S2 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 2-amino-N-(1-amino-1-oxo-4-sulfanylbutan-2-yl)-4-sulfanylbutanamide |
| SMILES | NC(=O)C(CCS)NC(=O)C(N)CCS |
| InChI | InChI=1S/C8H17N3O2S2/c9-5(1-3-14)8(13)11-6(2-4-15)7(10)12/h5-6,14-15H,1-4,9H2,(H2,10,12)(H,11,13) |
| InChIKey | DQKFEDRSQNMOKB-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|