C11H22N2O2S2 — CID 166832164
(2R)-2-amino-N-[(3S)-5,5-dimethyl-4-oxo-1-sulfanylhexan-3-yl]-3-sulfanylpropanamide (PubChem CID 166832164) has the molecular formula C11H22N2O2S2 and a molecular weight of 278.44 g/mol. Its IUPAC name is (2R)-2-amino-N-[(3S)-5,5-dimethyl-4-oxo-1-sulfanylhexan-3-yl]-3-sulfanylpropanamide.
| Compound Name | (2R)-2-amino-N-[(3S)-5,5-dimethyl-4-oxo-1-sulfanylhexan-3-yl]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 166832164 |
| Molecular Formula | C11H22N2O2S2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (2R)-2-amino-N-[(3S)-5,5-dimethyl-4-oxo-1-sulfanylhexan-3-yl]-3-sulfanylpropanamide |
| SMILES | CC(C)(C)C(=O)[C@H](CCS)NC(=O)[C@@H](N)CS |
| InChI | InChI=1S/C11H22N2O2S2/c1-11(2,3)9(14)8(4-5-16)13-10(15)7(12)6-17/h7-8,16-17H,4-6,12H2,1-3H3,(H,13,15)/t7-,8-/m0/s1 |
| InChIKey | SSRNTHHDIXQZRJ-YUMQZZPRSA-N |
| XLogP | 0.66 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|