C21H20O — CID 102163420
(1R)-1-(1,15-dimethyl-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)prop-2-yn-1-ol (PubChem CID 102163420) has the molecular formula C21H20O and a molecular weight of 288.39 g/mol. Its IUPAC name is (1R)-1-(1,15-dimethyl-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)prop-2-yn-1-ol.
| Compound Name | (1R)-1-(1,15-dimethyl-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)prop-2-yn-1-ol |
|---|---|
| PubChem CID | 102163420 |
| Molecular Formula | C21H20O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (1R)-1-(1,15-dimethyl-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)prop-2-yn-1-ol |
| SMILES | C#C[C@@H](O)C1(C)CC2c3ccccc3C1(C)c1ccccc12 |
| InChI | InChI=1S/C21H20O/c1-4-19(22)20(2)13-16-14-9-5-7-11-17(14)21(20,3)18-12-8-6-10-15(16)18/h1,5-12,16,19,22H,13H2,2-3H3/t16?,19-,20?,21?/m1/s1 |
| InChIKey | JJVWDCGBEWILRU-YZVUMYRFSA-N |
| XLogP | 3.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|