C11H11NO — CID 102163816
2-benzyl-5-methylidene-4H-1,3-oxazole (PubChem CID 102163816) has the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. Its IUPAC name is 2-benzyl-5-methylidene-4H-1,3-oxazole.
| Compound Name | 2-benzyl-5-methylidene-4H-1,3-oxazole |
|---|---|
| PubChem CID | 102163816 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 2-benzyl-5-methylidene-4H-1,3-oxazole |
| SMILES | C=C1CN=C(Cc2ccccc2)O1 |
| InChI | InChI=1S/C11H11NO/c1-9-8-12-11(13-9)7-10-5-3-2-4-6-10/h2-6H,1,7-8H2 |
| InChIKey | CFILEVSSOWKEOC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |