About (2-pyridin-2-ylphenyl) selenohypobromite
(2-pyridin-2-ylphenyl) selenohypobromite (PubChem CID 102165047) has the molecular formula C11H8BrNSe
and a molecular weight of 313.06 g/mol. Its IUPAC name is (2-pyridin-2-ylphenyl) selenohypobromite.
Molecular Properties
| Compound Name | (2-pyridin-2-ylphenyl) selenohypobromite |
| PubChem CID | 102165047 |
| Molecular Formula | C11H8BrNSe |
| Molecular Weight | 313.06 g/mol |
| Exact Mass | 312.90 |
| IUPAC Name | (2-pyridin-2-ylphenyl) selenohypobromite |
| SMILES | Br[Se]c1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C11H8BrNSe/c12-14-11-7-2-1-5-9(11)10-6-3-4-8-13-10/h1-8H |
| InChIKey | OYBBYGJKGJKDBS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.06 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-pyridin-2-ylphenyl) selenohypobromite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-pyridin-2-ylphenyl) selenohypobromite?
The IUPAC name of (2-pyridin-2-ylphenyl) selenohypobromite (CID 102165047) is (2-pyridin-2-ylphenyl) selenohypobromite.
What is the SMILES notation for (2-pyridin-2-ylphenyl) selenohypobromite?
The canonical SMILES for (2-pyridin-2-ylphenyl) selenohypobromite is Br[Se]c1ccccc1-c1ccccn1.
What is the InChIKey of (2-pyridin-2-ylphenyl) selenohypobromite?
The InChIKey is OYBBYGJKGJKDBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8BrNSe/c12-14-11-7-2-1-5-9(11)10-6-3-4-8-13-10/h1-8H.
What are the key properties of (2-pyridin-2-ylphenyl) selenohypobromite?
(2-pyridin-2-ylphenyl) selenohypobromite has a molecular weight of 313.06 g/mol, XLogP of 2.39, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-pyridin-2-ylphenyl) selenohypobromite is sourced from PubChem (CID 102165047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).