C25H25Cl3N4O — CID 102165211
4-(5-aminopent-1-ynyl)-N-tert-butyl-5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)pyrazole-3-carboxamide (PubChem CID 102165211) has the molecular formula C25H25Cl3N4O and a molecular weight of 503.86 g/mol. Its IUPAC name is 4-(5-aminopent-1-ynyl)-N-tert-butyl-5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)pyrazole-3-carboxamide.
| Compound Name | 4-(5-aminopent-1-ynyl)-N-tert-butyl-5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 102165211 |
| Molecular Formula | C25H25Cl3N4O |
| Molecular Weight | 503.86 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | 4-(5-aminopent-1-ynyl)-N-tert-butyl-5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)pyrazole-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1nn(-c2ccc(Cl)cc2Cl)c(-c2ccc(Cl)cc2)c1C#CCCCN |
| InChI | InChI=1S/C25H25Cl3N4O/c1-25(2,3)30-24(33)22-19(7-5-4-6-14-29)23(16-8-10-17(26)11-9-16)32(31-22)21-13-12-18(27)15-20(21)28/h8-13,15H,4,6,14,29H2,1-3H3,(H,30,33) |
| InChIKey | XNNGZCZBHHLTPZ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.86 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|