C25H26F3N3O4 — CID 102165218
prop-2-enyl N-[(2R)-2-(1H-indol-3-yl)-3-[[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]amino]propyl]carbamate (PubChem CID 102165218) has the molecular formula C25H26F3N3O4 and a molecular weight of 489.49 g/mol. Its IUPAC name is prop-2-enyl N-[(2R)-2-(1H-indol-3-yl)-3-[[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]amino]propyl]carbamate.
| Compound Name | prop-2-enyl N-[(2R)-2-(1H-indol-3-yl)-3-[[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 102165218 |
| Molecular Formula | C25H26F3N3O4 |
| Molecular Weight | 489.49 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | prop-2-enyl N-[(2R)-2-(1H-indol-3-yl)-3-[[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]amino]propyl]carbamate |
| SMILES | C=CCOC(=O)NC[C@@H](CNC(=O)[C@](OC)(c1ccccc1)C(F)(F)F)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C25H26F3N3O4/c1-3-13-35-23(33)31-15-17(20-16-29-21-12-8-7-11-19(20)21)14-30-22(32)24(34-2,25(26,27)28)18-9-5-4-6-10-18/h3-12,16-17,29H,1,13-15H2,2H3,(H,30,32)(H,31,33)/t17-,24-/m1/s1 |
| InChIKey | JOPDFDDUMIZATI-MZNJEOGPSA-N |
| XLogP | 4.38 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|