C11H17IO3 — CID 102165951
(5-butyl-4-iodo-3-methyl-2,5-dihydrofuran-2-yl) acetate (PubChem CID 102165951) has the molecular formula C11H17IO3 and a molecular weight of 324.16 g/mol. Its IUPAC name is (5-butyl-4-iodo-3-methyl-2,5-dihydrofuran-2-yl) acetate.
| Compound Name | (5-butyl-4-iodo-3-methyl-2,5-dihydrofuran-2-yl) acetate |
|---|---|
| PubChem CID | 102165951 |
| Molecular Formula | C11H17IO3 |
| Molecular Weight | 324.16 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | (5-butyl-4-iodo-3-methyl-2,5-dihydrofuran-2-yl) acetate |
| SMILES | CCCCC1OC(OC(C)=O)C(C)=C1I |
| InChI | InChI=1S/C11H17IO3/c1-4-5-6-9-10(12)7(2)11(15-9)14-8(3)13/h9,11H,4-6H2,1-3H3 |
| InChIKey | RGULRPMMEJWZEA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.16 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|