C27H33NO6 — CID 102166462
tert-butyl 2-(2,3,6,7-tetramethoxyphenanthren-9-yl)pyrrolidine-1-carboxylate (PubChem CID 102166462) has the molecular formula C27H33NO6 and a molecular weight of 467.56 g/mol. Its IUPAC name is tert-butyl 2-(2,3,6,7-tetramethoxyphenanthren-9-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(2,3,6,7-tetramethoxyphenanthren-9-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 102166462 |
| Molecular Formula | C27H33NO6 |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | tert-butyl 2-(2,3,6,7-tetramethoxyphenanthren-9-yl)pyrrolidine-1-carboxylate |
| SMILES | COc1cc2cc(C3CCCN3C(=O)OC(C)(C)C)c3cc(OC)c(OC)cc3c2cc1OC |
| InChI | InChI=1S/C27H33NO6/c1-27(2,3)34-26(29)28-10-8-9-21(28)20-11-16-12-22(30-4)23(31-5)13-17(16)18-14-24(32-6)25(33-7)15-19(18)20/h11-15,21H,8-10H2,1-7H3 |
| InChIKey | GULVWESTFKGNPZ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|