C20H34O4 — CID 102168643
[(5E,9E)-12-[3-(hydroxymethyl)-3-methyloxiran-2-yl]-6,10-dimethyldodeca-5,9-dien-2-yl] acetate (PubChem CID 102168643) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is [(5E,9E)-12-[3-(hydroxymethyl)-3-methyloxiran-2-yl]-6,10-dimethyldodeca-5,9-dien-2-yl] acetate.
| Compound Name | [(5E,9E)-12-[3-(hydroxymethyl)-3-methyloxiran-2-yl]-6,10-dimethyldodeca-5,9-dien-2-yl] acetate |
|---|---|
| PubChem CID | 102168643 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | [(5E,9E)-12-[3-(hydroxymethyl)-3-methyloxiran-2-yl]-6,10-dimethyldodeca-5,9-dien-2-yl] acetate |
| SMILES | CC(=O)OC(C)CC/C=C(\C)CC/C=C(\C)CCC1OC1(C)CO |
| InChI | InChI=1S/C20H34O4/c1-15(10-7-11-17(3)23-18(4)22)8-6-9-16(2)12-13-19-20(5,14-21)24-19/h9-10,17,19,21H,6-8,11-14H2,1-5H3/b15-10+,16-9+ |
| InChIKey | RRWVXPUWEYPKLY-BXIATTARSA-N |
| XLogP | 4.32 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|