C13H20O3 — CID 102181235
[(1R,4R,5R)-3,3-dimethyl-2-methylidene-4-propan-2-yl-6-oxabicyclo[3.1.0]hexan-1-yl] acetate (PubChem CID 102181235) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is [(1R,4R,5R)-3,3-dimethyl-2-methylidene-4-propan-2-yl-6-oxabicyclo[3.1.0]hexan-1-yl] acetate.
| Compound Name | [(1R,4R,5R)-3,3-dimethyl-2-methylidene-4-propan-2-yl-6-oxabicyclo[3.1.0]hexan-1-yl] acetate |
|---|---|
| PubChem CID | 102181235 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | [(1R,4R,5R)-3,3-dimethyl-2-methylidene-4-propan-2-yl-6-oxabicyclo[3.1.0]hexan-1-yl] acetate |
| SMILES | C=C1C(C)(C)[C@@H](C(C)C)[C@H]2O[C@@]12OC(C)=O |
| InChI | InChI=1S/C13H20O3/c1-7(2)10-11-13(16-11,15-9(4)14)8(3)12(10,5)6/h7,10-11H,3H2,1-2,4-6H3/t10-,11+,13-/m0/s1 |
| InChIKey | AEYUKAYAGZNSSB-LOWVWBTDSA-N |
| XLogP | 2.51 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|