C25H24BrNO7 — CID 102181775
methyl (5R,6R)-6-[(1S)-1-(4-bromophenyl)-2-nitroethyl]-5-(4-methoxyphenyl)-7-oxo-2,3,4,5-tetrahydrocyclopenta[b]pyran-6-carboxylate (PubChem CID 102181775) has the molecular formula C25H24BrNO7 and a molecular weight of 530.37 g/mol. Its IUPAC name is methyl (5R,6R)-6-[(1S)-1-(4-bromophenyl)-2-nitroethyl]-5-(4-methoxyphenyl)-7-oxo-2,3,4,5-tetrahydrocyclopenta[b]pyran-6-carboxylate.
| Compound Name | methyl (5R,6R)-6-[(1S)-1-(4-bromophenyl)-2-nitroethyl]-5-(4-methoxyphenyl)-7-oxo-2,3,4,5-tetrahydrocyclopenta[b]pyran-6-carboxylate |
|---|---|
| PubChem CID | 102181775 |
| Molecular Formula | C25H24BrNO7 |
| Molecular Weight | 530.37 g/mol |
| Exact Mass | 529.07 |
| IUPAC Name | methyl (5R,6R)-6-[(1S)-1-(4-bromophenyl)-2-nitroethyl]-5-(4-methoxyphenyl)-7-oxo-2,3,4,5-tetrahydrocyclopenta[b]pyran-6-carboxylate |
| SMILES | COC(=O)[C@]1([C@@H](C[N+](=O)[O-])c2ccc(Br)cc2)C(=O)C2=C(CCCO2)[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H24BrNO7/c1-32-18-11-7-16(8-12-18)21-19-4-3-13-34-22(19)23(28)25(21,24(29)33-2)20(14-27(30)31)15-5-9-17(26)10-6-15/h5-12,20-21H,3-4,13-14H2,1-2H3/t20-,21+,25-/m0/s1 |
| InChIKey | SUWRYYYJHNOEEA-BKSPAHHJSA-N |
| XLogP | 4.41 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|