C30H40N2O5 — CID 66918100
ethyl 4-[1-(4-methoxyphenyl)-2-nitroethyl]-1-[2-(4-methylphenyl)cyclohexyl]piperidine-4-carboxylate (PubChem CID 66918100) has the molecular formula C30H40N2O5 and a molecular weight of 508.66 g/mol. Its IUPAC name is ethyl 4-[1-(4-methoxyphenyl)-2-nitroethyl]-1-[2-(4-methylphenyl)cyclohexyl]piperidine-4-carboxylate.
| Compound Name | ethyl 4-[1-(4-methoxyphenyl)-2-nitroethyl]-1-[2-(4-methylphenyl)cyclohexyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 66918100 |
| Molecular Formula | C30H40N2O5 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.29 |
| IUPAC Name | ethyl 4-[1-(4-methoxyphenyl)-2-nitroethyl]-1-[2-(4-methylphenyl)cyclohexyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(C(C[N+](=O)[O-])c2ccc(OC)cc2)CCN(C2CCCCC2c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C30H40N2O5/c1-4-37-29(33)30(27(21-32(34)35)24-13-15-25(36-3)16-14-24)17-19-31(20-18-30)28-8-6-5-7-26(28)23-11-9-22(2)10-12-23/h9-16,26-28H,4-8,17-21H2,1-3H3 |
| InChIKey | RVCRNGMBKDMYMS-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|